C54H80Si — CID 162289442
bis[4-(3,5-ditert-butylphenyl)-6-ethyl-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 162289442) has the molecular formula C54H80Si and a molecular weight of 757.32 g/mol. Its IUPAC name is bis[4-(3,5-ditert-butylphenyl)-6-ethyl-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[4-(3,5-ditert-butylphenyl)-6-ethyl-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 162289442 |
| Molecular Formula | C54H80Si |
| Molecular Weight | 757.32 g/mol |
| Exact Mass | 756.60 |
| IUPAC Name | bis[4-(3,5-ditert-butylphenyl)-6-ethyl-2-methyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | CCC1=CC2C(CC(C)C2[Si](C)(C)C2C(C)CC3C(c4cc(C(C)(C)C)cc(C(C)(C)C)c4)=CC(CC)=CC32)C(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)=C1 |
| InChI | InChI=1S/C54H80Si/c1-19-35-23-43(37-27-39(51(5,6)7)31-40(28-37)52(8,9)10)45-21-33(3)49(47(45)25-35)55(17,18)50-34(4)22-46-44(24-36(20-2)26-48(46)50)38-29-41(53(11,12)13)32-42(30-38)54(14,15)16/h23-34,45-50H,19-22H2,1-18H3 |
| InChIKey | AMNZDTADMKEWBS-UHFFFAOYSA-N |
| XLogP | 16.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.32 |
| LogP ≤ 5 | 16.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|