C38H34F2N2+2 — CID 162289551
8,8'-difluoro-3-[4-(2,3,4,5-tetramethylcyclopentyl)phenyl]-6,6'-spirobi[pyrido[2,1-a]isoindol-5-ium] (PubChem CID 162289551) has the molecular formula C38H34F2N2+2 and a molecular weight of 556.70 g/mol. Its IUPAC name is 8,8'-difluoro-3-[4-(2,3,4,5-tetramethylcyclopentyl)phenyl]-6,6'-spirobi[pyrido[2,1-a]isoindol-5-ium].
| Compound Name | 8,8'-difluoro-3-[4-(2,3,4,5-tetramethylcyclopentyl)phenyl]-6,6'-spirobi[pyrido[2,1-a]isoindol-5-ium] |
|---|---|
| PubChem CID | 162289551 |
| Molecular Formula | C38H34F2N2+2 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 8,8'-difluoro-3-[4-(2,3,4,5-tetramethylcyclopentyl)phenyl]-6,6'-spirobi[pyrido[2,1-a]isoindol-5-ium] |
| SMILES | CC1C(C)C(C)C(c2ccc(-c3ccc4[n+](c3)C3(c5cc(F)ccc5-c5cccc[n+]53)c3cc(F)ccc3-4)cc2)C1C |
| InChI | InChI=1S/C38H34F2N2/c1-22-23(2)25(4)37(24(22)3)27-10-8-26(9-11-27)28-12-17-36-32-16-14-30(40)20-34(32)38(42(36)21-28)33-19-29(39)13-15-31(33)35-7-5-6-18-41(35)38/h5-25,37H,1-4H3/q+2 |
| InChIKey | YIDVMFRVSFPKKA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|