C33H58F2O — CID 162290393
4,8-difluoro-2-hexyl-2-methyl-6-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)cyclohexyl]-1-oxaspiro[2.5]octane;molecular hydrogen (PubChem CID 162290393) has the molecular formula C33H58F2O and a molecular weight of 508.82 g/mol. Its IUPAC name is 4,8-difluoro-2-hexyl-2-methyl-6-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)cyclohexyl]-1-oxaspiro[2.5]octane;molecular hydrogen.
| Compound Name | 4,8-difluoro-2-hexyl-2-methyl-6-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)cyclohexyl]-1-oxaspiro[2.5]octane;molecular hydrogen |
|---|---|
| PubChem CID | 162290393 |
| Molecular Formula | C33H58F2O |
| Molecular Weight | 508.82 g/mol |
| Exact Mass | 508.45 |
| IUPAC Name | 4,8-difluoro-2-hexyl-2-methyl-6-[4-(4-pentyl-1-bicyclo[2.2.2]octanyl)cyclohexyl]-1-oxaspiro[2.5]octane;molecular hydrogen |
| SMILES | CCCCCCC1(C)OC12C(F)CC(C1CCC(C34CCC(CCCCC)(CC3)CC4)CC1)CC2F.[H][H] |
| InChI | InChI=1S/C33H56F2O.H2/c1-4-6-8-10-15-30(3)33(36-30)28(34)23-26(24-29(33)35)25-11-13-27(14-12-25)32-20-17-31(18-21-32,19-22-32)16-9-7-5-2;/h25-29H,4-24H2,1-3H3;1H |
| InChIKey | CLEIQJQGRMTRMI-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.82 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|