About 7-ethyl-1,2,3,8-tetramethylnaphthalene
7-ethyl-1,2,3,8-tetramethylnaphthalene (PubChem CID 162292672) has the molecular formula C16H20
and a molecular weight of 212.34 g/mol. Its IUPAC name is 7-ethyl-1,2,3,8-tetramethylnaphthalene.
Molecular Properties
| Compound Name | 7-ethyl-1,2,3,8-tetramethylnaphthalene |
| PubChem CID | 162292672 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 7-ethyl-1,2,3,8-tetramethylnaphthalene |
| SMILES | CCc1ccc2cc(C)c(C)c(C)c2c1C |
| InChI | InChI=1S/C16H20/c1-6-14-7-8-15-9-10(2)11(3)12(4)16(15)13(14)5/h7-9H,6H2,1-5H3 |
| InChIKey | XUMPYPYLBJWWNE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-ethyl-1,2,3,8-tetramethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-1,2,3,8-tetramethylnaphthalene?
The IUPAC name of 7-ethyl-1,2,3,8-tetramethylnaphthalene (CID 162292672) is 7-ethyl-1,2,3,8-tetramethylnaphthalene.
What is the SMILES notation for 7-ethyl-1,2,3,8-tetramethylnaphthalene?
The canonical SMILES for 7-ethyl-1,2,3,8-tetramethylnaphthalene is CCc1ccc2cc(C)c(C)c(C)c2c1C.
What is the InChIKey of 7-ethyl-1,2,3,8-tetramethylnaphthalene?
The InChIKey is XUMPYPYLBJWWNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20/c1-6-14-7-8-15-9-10(2)11(3)12(4)16(15)13(14)5/h7-9H,6H2,1-5H3.
What are the key properties of 7-ethyl-1,2,3,8-tetramethylnaphthalene?
7-ethyl-1,2,3,8-tetramethylnaphthalene has a molecular weight of 212.34 g/mol, XLogP of 4.64, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-1,2,3,8-tetramethylnaphthalene is sourced from PubChem (CID 162292672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).