About CID 162293667
CID 162293667 (PubChem CID 162293667) has the molecular formula C8H17Li2N
and a molecular weight of 141.11 g/mol.
Molecular Properties
| Compound Name | CID 162293667 |
| PubChem CID | 162293667 |
| Molecular Formula | C8H17Li2N |
| Molecular Weight | 141.11 g/mol |
| Exact Mass | 141.17 |
| IUPAC Name | — |
| SMILES | CNC(C)C1CCCC1.[Li][Li] |
| InChI | InChI=1S/C8H17N.2Li/c1-7(9-2)8-5-3-4-6-8;;/h7-9H,3-6H2,1-2H3;; |
| InChIKey | NOQBIKXHAODRTE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.11 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 162293667 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162293667?
The IUPAC name of CID 162293667 (CID 162293667) is not available.
What is the SMILES notation for CID 162293667?
The canonical SMILES for CID 162293667 is CNC(C)C1CCCC1.[Li][Li].
What is the InChIKey of CID 162293667?
The InChIKey is NOQBIKXHAODRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.2Li/c1-7(9-2)8-5-3-4-6-8;;/h7-9H,3-6H2,1-2H3;;.
What are the key properties of CID 162293667?
CID 162293667 has a molecular weight of 141.11 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162293667 is sourced from PubChem (CID 162293667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).