C11H16O3 — CID 162293965
9,9-dimethoxynona-1,3,5,7-tetraen-1-ol (PubChem CID 162293965) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 9,9-dimethoxynona-1,3,5,7-tetraen-1-ol.
| Compound Name | 9,9-dimethoxynona-1,3,5,7-tetraen-1-ol |
|---|---|
| PubChem CID | 162293965 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 9,9-dimethoxynona-1,3,5,7-tetraen-1-ol |
| SMILES | COC(C=CC=CC=CC=CO)OC |
| InChI | InChI=1S/C11H16O3/c1-13-11(14-2)9-7-5-3-4-6-8-10-12/h3-12H,1-2H3 |
| InChIKey | OBSUNPAQJLOIHD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|