C48H76O2Si — CID 162294698
bis[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane (PubChem CID 162294698) has the molecular formula C48H76O2Si and a molecular weight of 713.22 g/mol. Its IUPAC name is bis[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane.
| Compound Name | bis[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 162294698 |
| Molecular Formula | C48H76O2Si |
| Molecular Weight | 713.22 g/mol |
| Exact Mass | 712.56 |
| IUPAC Name | bis[6-tert-butyl-4-(3,5-dimethylphenyl)-5-methoxy-2-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]-dimethylsilane |
| SMILES | COC1C(c2cc(C)cc(C)c2)C2CC(C)C([Si](C)(C)C3C(C)CC4C3CC(C(C)(C)C)C(OC)C4c3cc(C)cc(C)c3)C2CC1C(C)(C)C |
| InChI | InChI=1S/C48H76O2Si/c1-27-17-28(2)20-33(19-27)41-35-23-31(5)45(37(35)25-39(43(41)49-13)47(7,8)9)51(15,16)46-32(6)24-36-38(46)26-40(48(10,11)12)44(50-14)42(36)34-21-29(3)18-30(4)22-34/h17-22,31-32,35-46H,23-26H2,1-16H3 |
| InChIKey | IMCPQWMYMHTSFL-UHFFFAOYSA-N |
| XLogP | 12.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.22 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|