C23H27NO2 — CID 162295910
1,10,13,18,18,19,19-heptamethyl-3,7-dioxa-11-azapentacyclo[9.8.0.02,9.04,8.012,17]nonadeca-2(9),4(8),5,12,14,16-hexaene (PubChem CID 162295910) has the molecular formula C23H27NO2 and a molecular weight of 349.47 g/mol. Its IUPAC name is 1,10,13,18,18,19,19-heptamethyl-3,7-dioxa-11-azapentacyclo[9.8.0.02,9.04,8.012,17]nonadeca-2(9),4(8),5,12,14,16-hexaene.
| Compound Name | 1,10,13,18,18,19,19-heptamethyl-3,7-dioxa-11-azapentacyclo[9.8.0.02,9.04,8.012,17]nonadeca-2(9),4(8),5,12,14,16-hexaene |
|---|---|
| PubChem CID | 162295910 |
| Molecular Formula | C23H27NO2 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 1,10,13,18,18,19,19-heptamethyl-3,7-dioxa-11-azapentacyclo[9.8.0.02,9.04,8.012,17]nonadeca-2(9),4(8),5,12,14,16-hexaene |
| SMILES | Cc1cccc2c1N1C(C)c3c(oc4ccoc34)C1(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C23H27NO2/c1-13-9-8-10-15-18(13)24-14(2)17-19-16(11-12-25-19)26-20(17)23(24,7)22(5,6)21(15,3)4/h8-12,14H,1-7H3 |
| InChIKey | KDAFUBZIPXLBJQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |