C19H30N2 — CID 162296028
1,3,4,7,7-pentamethyl-2-(2,4,6-trimethyl-3-pyridinyl)-2-azabicyclo[2.2.1]heptane (PubChem CID 162296028) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 1,3,4,7,7-pentamethyl-2-(2,4,6-trimethyl-3-pyridinyl)-2-azabicyclo[2.2.1]heptane.
| Compound Name | 1,3,4,7,7-pentamethyl-2-(2,4,6-trimethyl-3-pyridinyl)-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 162296028 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1,3,4,7,7-pentamethyl-2-(2,4,6-trimethyl-3-pyridinyl)-2-azabicyclo[2.2.1]heptane |
| SMILES | Cc1cc(C)c(N2C(C)C3(C)CCC2(C)C3(C)C)c(C)n1 |
| InChI | InChI=1S/C19H30N2/c1-12-11-13(2)20-14(3)16(12)21-15(4)18(7)9-10-19(21,8)17(18,5)6/h11,15H,9-10H2,1-8H3 |
| InChIKey | UWDVOVUUWLULKN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |