About 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide
2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 16229687) has the molecular formula C26H25N3O4
and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide |
| PubChem CID | 16229687 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COC1=CC=CC=C1CNC(=O)CN2C(=O)C(NC2=O)(CC3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | InChI=1S/C26H25N3O4/c1-33-22-15-9-8-12-20(22)17-27-23(30)18-29-24(31)26(28-25(29)32,21-13-6-3-7-14-21)16-19-10-4-2-5-11-19/h2-15H,16-18H2,1H3,(H,27,30)(H,28,32) |
| InChIKey | RGEGHEYZSGZKPA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | 702 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide?
The IUPAC name of 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide (CID 16229687) is 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide.
What is the SMILES notation for 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide?
The canonical SMILES for 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide is COC1=CC=CC=C1CNC(=O)CN2C(=O)C(NC2=O)(CC3=CC=CC=C3)C4=CC=CC=C4.
What is the InChIKey of 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide?
The InChIKey is RGEGHEYZSGZKPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O4/c1-33-22-15-9-8-12-20(22)17-27-23(30)18-29-24(31)26(28-25(29)32,21-13-6-3-7-14-21)16-19-10-4-2-5-11-19/h2-15H,16-18H2,1H3,(H,27,30)(H,28,32).
What are the key properties of 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide?
2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide has a molecular weight of 443.50 g/mol, XLogP of 3.40, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-benzyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide is sourced from PubChem (CID 16229687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).