C21H26Cl3NTi — CID 162297953
carbanide;trichlorotitanium(1+);1,2,3-trimethyl-4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole (PubChem CID 162297953) has the molecular formula C21H26Cl3NTi and a molecular weight of 446.67 g/mol. Its IUPAC name is carbanide;trichlorotitanium(1+);1,2,3-trimethyl-4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole.
| Compound Name | carbanide;trichlorotitanium(1+);1,2,3-trimethyl-4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole |
|---|---|
| PubChem CID | 162297953 |
| Molecular Formula | C21H26Cl3NTi |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | carbanide;trichlorotitanium(1+);1,2,3-trimethyl-4-phenyl-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indole |
| SMILES | CC1C(C)C2c3ccccc3N(c3ccccc3)C2C1C.Cl[Ti+](Cl)Cl.[CH3-] |
| InChI | InChI=1S/C20H23N.CH3.3ClH.Ti/c1-13-14(2)19-17-11-7-8-12-18(17)21(20(19)15(13)3)16-9-5-4-6-10-16;;;;;/h4-15,19-20H,1-3H3;1H3;3*1H;/q;-1;;;;+4/p-3 |
| InChIKey | PXBJAZGTBBGCPO-UHFFFAOYSA-K |
| XLogP | 7.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|