C45H89I — CID 162298705
[2,6-dimethyl-3,5-di(propan-2-yl)hepta-2,5-dien-4-yl]-bis[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane (PubChem CID 162298705) has the molecular formula C45H89I and a molecular weight of 757.11 g/mol. Its IUPAC name is [2,6-dimethyl-3,5-di(propan-2-yl)hepta-2,5-dien-4-yl]-bis[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane.
| Compound Name | [2,6-dimethyl-3,5-di(propan-2-yl)hepta-2,5-dien-4-yl]-bis[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane |
|---|---|
| PubChem CID | 162298705 |
| Molecular Formula | C45H89I |
| Molecular Weight | 757.11 g/mol |
| Exact Mass | 756.60 |
| IUPAC Name | [2,6-dimethyl-3,5-di(propan-2-yl)hepta-2,5-dien-4-yl]-bis[2,6-dimethyl-3,5-di(propan-2-yl)heptan-4-yl]-λ3-iodane |
| SMILES | CC(C)=C(C(C)C)C(C(=C(C)C)C(C)C)I(C(C(C(C)C)C(C)C)C(C(C)C)C(C)C)C(C(C(C)C)C(C)C)C(C(C)C)C(C)C |
| InChI | InChI=1S/C45H89I/c1-25(2)37(26(3)4)43(38(27(5)6)28(7)8)46(44(39(29(9)10)30(11)12)40(31(13)14)32(15)16)45(41(33(17)18)34(19)20)42(35(21)22)36(23)24/h25-33,35,37-40,43-45H,1-24H3 |
| InChIKey | QXRRSBFYUBIJKS-UHFFFAOYSA-N |
| XLogP | 15.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.11 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|