C20H20N4 — CID 162299211
2-[(5E)-5-[cyano(isocyano)methylidene]-2,7-dimethyl-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacen-4-ylidene]-2-isocyanoacetonitrile (PubChem CID 162299211) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-[(5E)-5-[cyano(isocyano)methylidene]-2,7-dimethyl-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacen-4-ylidene]-2-isocyanoacetonitrile.
| Compound Name | 2-[(5E)-5-[cyano(isocyano)methylidene]-2,7-dimethyl-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacen-4-ylidene]-2-isocyanoacetonitrile |
|---|---|
| PubChem CID | 162299211 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-[(5E)-5-[cyano(isocyano)methylidene]-2,7-dimethyl-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacen-4-ylidene]-2-isocyanoacetonitrile |
| SMILES | [C-]#[N+]C(C#N)=C1/C(=C(\C#N)[N+]#[C-])C2CC(C)CC2C2CC(C)CC12 |
| InChI | InChI=1S/C20H20N4/c1-11-5-13-14-6-12(2)8-16(14)20(18(10-22)24-4)19(15(13)7-11)17(9-21)23-3/h11-16H,5-8H2,1-2H3/b19-17+,20-18? |
| InChIKey | JAJOIEGGFAMUNI-KWNZBJHBSA-N |
| XLogP | 4.72 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|