C23H29F3N4O — CID 162299294
4-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-ylmethyl)-N-[(4-methylphenyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine (PubChem CID 162299294) has the molecular formula C23H29F3N4O and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-ylmethyl)-N-[(4-methylphenyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-ylmethyl)-N-[(4-methylphenyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 162299294 |
| Molecular Formula | C23H29F3N4O |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-ylmethyl)-N-[(4-methylphenyl)methyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(CNc2nc(CC3CCC4CCCC4C3)nc(OCC(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C23H29F3N4O/c1-15-5-7-16(8-6-15)13-27-21-28-20(29-22(30-21)31-14-23(24,25)26)12-17-9-10-18-3-2-4-19(18)11-17/h5-8,17-19H,2-4,9-14H2,1H3,(H,27,28,29,30) |
| InChIKey | HIQHZHRJEILIGB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |