C19H28N6S3 — CID 162299432
2,5-dimethyl-1H-imidazole;2,5-dimethyl-1,3,4-thiadiazole;2,4-dimethyl-1,3-thiazole;2,5-dimethyl-1,3-thiazole (PubChem CID 162299432) has the molecular formula C19H28N6S3 and a molecular weight of 436.68 g/mol. Its IUPAC name is 2,5-dimethyl-1H-imidazole;2,5-dimethyl-1,3,4-thiadiazole;2,4-dimethyl-1,3-thiazole;2,5-dimethyl-1,3-thiazole.
| Compound Name | 2,5-dimethyl-1H-imidazole;2,5-dimethyl-1,3,4-thiadiazole;2,4-dimethyl-1,3-thiazole;2,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 162299432 |
| Molecular Formula | C19H28N6S3 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2,5-dimethyl-1H-imidazole;2,5-dimethyl-1,3,4-thiadiazole;2,4-dimethyl-1,3-thiazole;2,5-dimethyl-1,3-thiazole |
| SMILES | Cc1cnc(C)[nH]1.Cc1cnc(C)s1.Cc1csc(C)n1.Cc1nnc(C)s1 |
| InChI | InChI=1S/C5H8N2.2C5H7NS.C4H6N2S/c1-4-3-6-5(2)7-4;1-4-3-7-5(2)6-4;1-4-3-6-5(2)7-4;1-3-5-6-4(2)7-3/h3H,1-2H3,(H,6,7);2*3H,1-2H3;1-2H3 |
| InChIKey | WSFYTLARRFEMLZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |