C17H27N4+ — CID 162299442
cyclohexatriene;1,3-dimethyl-2H-imidazole;1,2,3-trimethyl-2H-imidazole (PubChem CID 162299442) has the molecular formula C17H27N4+ and a molecular weight of 287.43 g/mol. Its IUPAC name is cyclohexatriene;1,3-dimethyl-2H-imidazole;1,2,3-trimethyl-2H-imidazole.
| Compound Name | cyclohexatriene;1,3-dimethyl-2H-imidazole;1,2,3-trimethyl-2H-imidazole |
|---|---|
| PubChem CID | 162299442 |
| Molecular Formula | C17H27N4+ |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | cyclohexatriene;1,3-dimethyl-2H-imidazole;1,2,3-trimethyl-2H-imidazole |
| SMILES | CC1N(C)C=CN1C.CN1C=CN(C)C1.[C+]1=CC=CC=C1 |
| InChI | InChI=1S/C6H12N2.C6H5.C5H10N2/c1-6-7(2)4-5-8(6)3;1-2-4-6-5-3-1;1-6-3-4-7(2)5-6/h4-6H,1-3H3;1-5H;3-4H,5H2,1-2H3/q;+1; |
| InChIKey | FMOHXVGVRPHGRY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|