About N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride
N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride (PubChem CID 162300042) has the molecular formula C9H17BF4N3O-
and a molecular weight of 270.06 g/mol. Its IUPAC name is N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride.
Molecular Properties
| Compound Name | N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride |
| PubChem CID | 162300042 |
| Molecular Formula | C9H17BF4N3O- |
| Molecular Weight | 270.06 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride |
| SMILES | CC(=O)NCCCN1C=CN(C)C1.FB(F)F.[F-] |
| InChI | InChI=1S/C9H17N3O.BF3.FH/c1-9(13)10-4-3-5-12-7-6-11(2)8-12;2-1(3)4;/h6-7H,3-5,8H2,1-2H3,(H,10,13);;1H/p-1 |
| InChIKey | VFXKLSVNDSNLQB-UHFFFAOYSA-M |
| XLogP | -1.93 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.06 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride?
The IUPAC name of N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride (CID 162300042) is N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride.
What is the SMILES notation for N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride?
The canonical SMILES for N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride is CC(=O)NCCCN1C=CN(C)C1.FB(F)F.[F-].
What is the InChIKey of N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride?
The InChIKey is VFXKLSVNDSNLQB-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H17N3O.BF3.FH/c1-9(13)10-4-3-5-12-7-6-11(2)8-12;2-1(3)4;/h6-7H,3-5,8H2,1-2H3,(H,10,13);;1H/p-1.
What are the key properties of N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride?
N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride has a molecular weight of 270.06 g/mol, XLogP of -1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3-methyl-2H-imidazol-1-yl)propyl]acetamide;trifluoroborane;fluoride is sourced from PubChem (CID 162300042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).