C28H45Cl2MnN5O4 — CID 162301419
carbon dioxide;dichloromanganese;(4R,9R,14R,19R)-24-pentyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene-23-carboxylic acid (PubChem CID 162301419) has the molecular formula C28H45Cl2MnN5O4 and a molecular weight of 641.54 g/mol. Its IUPAC name is carbon dioxide;dichloromanganese;(4R,9R,14R,19R)-24-pentyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene-23-carboxylic acid.
| Compound Name | carbon dioxide;dichloromanganese;(4R,9R,14R,19R)-24-pentyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene-23-carboxylic acid |
|---|---|
| PubChem CID | 162301419 |
| Molecular Formula | C28H45Cl2MnN5O4 |
| Molecular Weight | 641.54 g/mol |
| Exact Mass | 640.22 |
| IUPAC Name | carbon dioxide;dichloromanganese;(4R,9R,14R,19R)-24-pentyl-3,10,13,20,26-pentazatetracyclo[20.3.1.04,9.014,19]hexacosa-1(25),22(26),23-triene-23-carboxylic acid |
| SMILES | CCCCCc1cc2nc(c1C(=O)O)CN[C@@H]1CCCC[C@H]1NCCN[C@@H]1CCCC[C@H]1NC2.Cl[Mn]Cl.O=C=O |
| InChI | InChI=1S/C27H45N5O2.CO2.2ClH.Mn/c1-2-3-4-9-19-16-20-17-30-23-12-7-5-10-21(23)28-14-15-29-22-11-6-8-13-24(22)31-18-25(32-20)26(19)27(33)34;2-1-3;;;/h16,21-24,28-31H,2-15,17-18H2,1H3,(H,33,34);;2*1H;/q;;;;+2/p-2/t21-,22-,23-,24-;;;;/m1..../s1 |
| InChIKey | LEAGDDLSIAFPBJ-WZKYTSAHSA-L |
| XLogP | 4.30 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|