C37H76N2O — CID 162302054
2,5,9,11-tetramethyl-3-tritiotridecan-7-imine;N-(2,5,9,11-tetramethyl-3-tritiotridecan-7-yl)propanamide (PubChem CID 162302054) has the molecular formula C37H76N2O and a molecular weight of 569.04 g/mol. Its IUPAC name is 2,5,9,11-tetramethyl-3-tritiotridecan-7-imine;N-(2,5,9,11-tetramethyl-3-tritiotridecan-7-yl)propanamide.
| Compound Name | 2,5,9,11-tetramethyl-3-tritiotridecan-7-imine;N-(2,5,9,11-tetramethyl-3-tritiotridecan-7-yl)propanamide |
|---|---|
| PubChem CID | 162302054 |
| Molecular Formula | C37H76N2O |
| Molecular Weight | 569.04 g/mol |
| Exact Mass | 568.61 |
| IUPAC Name | 2,5,9,11-tetramethyl-3-tritiotridecan-7-imine;N-(2,5,9,11-tetramethyl-3-tritiotridecan-7-yl)propanamide |
| SMILES | [3H]C(CC(C)CC(CC(C)CC(C)CC)NC(=O)CC)C(C)C.[H]/N=C(/CC(C)CC(C)CC)CC(C)CC([3H])C(C)C |
| InChI | InChI=1S/C20H41NO.C17H35N/c1-8-16(5)12-18(7)14-19(21-20(22)9-2)13-17(6)11-10-15(3)4;1-7-14(4)10-16(6)12-17(18)11-15(5)9-8-13(2)3/h15-19H,8-14H2,1-7H3,(H,21,22);13-16,18H,7-12H2,1-6H3/b;18-17+/i10T;8T |
| InChIKey | UYDIRVAVLLBTKK-LFDWVXPNSA-N |
| XLogP | 11.74 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.04 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|