About N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine
N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine (PubChem CID 162302282) has the molecular formula C15H32NSi+
and a molecular weight of 254.51 g/mol. Its IUPAC name is N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine |
| PubChem CID | 162302282 |
| Molecular Formula | C15H32NSi+ |
| Molecular Weight | 254.51 g/mol |
| Exact Mass | 254.23 |
| IUPAC Name | N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine |
| SMILES | [CH2+]C1C(C)C(C)C([Si](C)(C)NC(C)(C)C)C1C |
| InChI | InChI=1S/C15H32NSi/c1-10-11(2)13(4)14(12(10)3)17(8,9)16-15(5,6)7/h10-14,16H,1H2,2-9H3/q+1 |
| InChIKey | HMHMYTJFRRTRDO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine?
The IUPAC name of N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine (CID 162302282) is N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine is [CH2+]C1C(C)C(C)C([Si](C)(C)NC(C)(C)C)C1C.
What is the InChIKey of N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine?
The InChIKey is HMHMYTJFRRTRDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32NSi/c1-10-11(2)13(4)14(12(10)3)17(8,9)16-15(5,6)7/h10-14,16H,1H2,2-9H3/q+1.
What are the key properties of N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine?
N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine has a molecular weight of 254.51 g/mol, XLogP of 4.32, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dimethyl-(2,4,5-trimethyl-3-methylcyclopentyl)silyl]-2-methylpropan-2-amine is sourced from PubChem (CID 162302282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).