C28H25N3O3+2 — CID 162302784
(1S,15R,19R)-19-benzyl-6-phenyl-2-oxa-13-aza-5,19-diazoniapentacyclo[11.6.0.01,5.07,12.015,19]nonadeca-5,7,9,11-tetraene-3,14-dione (PubChem CID 162302784) has the molecular formula C28H25N3O3+2 and a molecular weight of 451.53 g/mol. Its IUPAC name is (1S,15R,19R)-19-benzyl-6-phenyl-2-oxa-13-aza-5,19-diazoniapentacyclo[11.6.0.01,5.07,12.015,19]nonadeca-5,7,9,11-tetraene-3,14-dione.
| Compound Name | (1S,15R,19R)-19-benzyl-6-phenyl-2-oxa-13-aza-5,19-diazoniapentacyclo[11.6.0.01,5.07,12.015,19]nonadeca-5,7,9,11-tetraene-3,14-dione |
|---|---|
| PubChem CID | 162302784 |
| Molecular Formula | C28H25N3O3+2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (1S,15R,19R)-19-benzyl-6-phenyl-2-oxa-13-aza-5,19-diazoniapentacyclo[11.6.0.01,5.07,12.015,19]nonadeca-5,7,9,11-tetraene-3,14-dione |
| SMILES | O=C1C[N+]2=C(c3ccccc3)c3ccccc3N3C(=O)[C@H]4CCC[N@+]4(Cc4ccccc4)[C@@]32O1 |
| InChI | InChI=1S/C28H25N3O3/c32-25-18-29-26(21-12-5-2-6-13-21)22-14-7-8-15-23(22)30-27(33)24-16-9-17-31(24,28(29,30)34-25)19-20-10-3-1-4-11-20/h1-8,10-15,24H,9,16-19H2/q+2/t24-,28+,31-/m1/s1 |
| InChIKey | SPCFEQYPGLDAFS-YIHZDXAJSA-N |
| XLogP | 3.24 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|