C10H14ClN2OOs-2 — CID 162303268
chloro(hydrido)osmium;methanone;N-(pyridin-2-ylmethyl)propan-1-amine (PubChem CID 162303268) has the molecular formula C10H14ClN2OOs-2 and a molecular weight of 403.92 g/mol. Its IUPAC name is chloro(hydrido)osmium;methanone;N-(pyridin-2-ylmethyl)propan-1-amine.
| Compound Name | chloro(hydrido)osmium;methanone;N-(pyridin-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 162303268 |
| Molecular Formula | C10H14ClN2OOs-2 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | chloro(hydrido)osmium;methanone;N-(pyridin-2-ylmethyl)propan-1-amine |
| SMILES | Cl[Os].[CH-]=O.[CH2-]CCNCc1ccccn1 |
| InChI | InChI=1S/C9H13N2.CHO.ClH.Os/c1-2-6-10-8-9-5-3-4-7-11-9;1-2;;/h3-5,7,10H,1-2,6,8H2;1H;1H;/q2*-1;;+1/p-1 |
| InChIKey | MAKSEKSTAZGQSM-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|