About 4,5-dibutyl-1,3-dimethyl-2H-imidazole
4,5-dibutyl-1,3-dimethyl-2H-imidazole (PubChem CID 162303314) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 4,5-dibutyl-1,3-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 4,5-dibutyl-1,3-dimethyl-2H-imidazole |
| PubChem CID | 162303314 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4,5-dibutyl-1,3-dimethyl-2H-imidazole |
| SMILES | CCCCC1=C(CCCC)N(C)CN1C |
| InChI | InChI=1S/C13H26N2/c1-5-7-9-12-13(10-8-6-2)15(4)11-14(12)3/h5-11H2,1-4H3 |
| InChIKey | ZNQPCQSAFSPEKU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dibutyl-1,3-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dibutyl-1,3-dimethyl-2H-imidazole?
The IUPAC name of 4,5-dibutyl-1,3-dimethyl-2H-imidazole (CID 162303314) is 4,5-dibutyl-1,3-dimethyl-2H-imidazole.
What is the SMILES notation for 4,5-dibutyl-1,3-dimethyl-2H-imidazole?
The canonical SMILES for 4,5-dibutyl-1,3-dimethyl-2H-imidazole is CCCCC1=C(CCCC)N(C)CN1C.
What is the InChIKey of 4,5-dibutyl-1,3-dimethyl-2H-imidazole?
The InChIKey is ZNQPCQSAFSPEKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-5-7-9-12-13(10-8-6-2)15(4)11-14(12)3/h5-11H2,1-4H3.
What are the key properties of 4,5-dibutyl-1,3-dimethyl-2H-imidazole?
4,5-dibutyl-1,3-dimethyl-2H-imidazole has a molecular weight of 210.36 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dibutyl-1,3-dimethyl-2H-imidazole is sourced from PubChem (CID 162303314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).