C10H10AlNO — CID 162303797
1,3-dihydro-[1,3,2]oxazalumolo[4,3-j]quinoline (PubChem CID 162303797) has the molecular formula C10H10AlNO and a molecular weight of 187.18 g/mol. Its IUPAC name is 1,3-dihydro-[1,3,2]oxazalumolo[4,3-j]quinoline.
| Compound Name | 1,3-dihydro-[1,3,2]oxazalumolo[4,3-j]quinoline |
|---|---|
| PubChem CID | 162303797 |
| Molecular Formula | C10H10AlNO |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 1,3-dihydro-[1,3,2]oxazalumolo[4,3-j]quinoline |
| SMILES | C1=CC2=CC=CN3[AlH]OCC23C=C1 |
| InChI | InChI=1S/C10H9NO.Al.H/c12-8-10-6-2-1-4-9(10)5-3-7-11-10;;/h1-7H,8H2;;/q-2;+2; |
| InChIKey | UAVBBGCXPABUSV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |