C13H16N2O4S — CID 162304975
(E)-but-2-enedioic acid;5-methyl-2-(1,2,3,6-tetrahydropyridin-5-yl)-1,3-thiazole (PubChem CID 162304975) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-methyl-2-(1,2,3,6-tetrahydropyridin-5-yl)-1,3-thiazole.
| Compound Name | (E)-but-2-enedioic acid;5-methyl-2-(1,2,3,6-tetrahydropyridin-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 162304975 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (E)-but-2-enedioic acid;5-methyl-2-(1,2,3,6-tetrahydropyridin-5-yl)-1,3-thiazole |
| SMILES | Cc1cnc(C2=CCCNC2)s1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C9H12N2S.C4H4O4/c1-7-5-11-9(12-7)8-3-2-4-10-6-8;5-3(6)1-2-4(7)8/h3,5,10H,2,4,6H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UBBFHWOAZLBRGL-WLHGVMLRSA-N |
| XLogP | 1.54 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|