About benzene-1,2,4,5-tetramine;trihydrochloride
benzene-1,2,4,5-tetramine;trihydrochloride (PubChem CID 162304988) has the molecular formula C6H13Cl3N4
and a molecular weight of 247.56 g/mol. Its IUPAC name is benzene-1,2,4,5-tetramine;trihydrochloride.
Molecular Properties
| Compound Name | benzene-1,2,4,5-tetramine;trihydrochloride |
| PubChem CID | 162304988 |
| Molecular Formula | C6H13Cl3N4 |
| Molecular Weight | 247.56 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | benzene-1,2,4,5-tetramine;trihydrochloride |
| SMILES | Cl.Cl.Cl.Nc1cc(N)c(N)cc1N |
| InChI | InChI=1S/C6H10N4.3ClH/c7-3-1-4(8)6(10)2-5(3)9;;;/h1-2H,7-10H2;3*1H |
| InChIKey | XMROIHAGRBJEAE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.56 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2,4,5-tetramine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2,4,5-tetramine;trihydrochloride?
The IUPAC name of benzene-1,2,4,5-tetramine;trihydrochloride (CID 162304988) is benzene-1,2,4,5-tetramine;trihydrochloride.
What is the SMILES notation for benzene-1,2,4,5-tetramine;trihydrochloride?
The canonical SMILES for benzene-1,2,4,5-tetramine;trihydrochloride is Cl.Cl.Cl.Nc1cc(N)c(N)cc1N.
What is the InChIKey of benzene-1,2,4,5-tetramine;trihydrochloride?
The InChIKey is XMROIHAGRBJEAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4.3ClH/c7-3-1-4(8)6(10)2-5(3)9;;;/h1-2H,7-10H2;3*1H.
What are the key properties of benzene-1,2,4,5-tetramine;trihydrochloride?
benzene-1,2,4,5-tetramine;trihydrochloride has a molecular weight of 247.56 g/mol, XLogP of 1.28, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2,4,5-tetramine;trihydrochloride is sourced from PubChem (CID 162304988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).