About hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate
hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate (PubChem CID 162307739) has the molecular formula C13H14F6NOP
and a molecular weight of 345.22 g/mol. Its IUPAC name is hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate.
Molecular Properties
| Compound Name | hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate |
| PubChem CID | 162307739 |
| Molecular Formula | C13H14F6NOP |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.O=C(CN1C=CC=CC1)c1ccccc1.[H+] |
| InChI | InChI=1S/C13H13NO.F6P/c15-13(12-7-3-1-4-8-12)11-14-9-5-2-6-10-14;1-7(2,3,4,5)6/h1-9H,10-11H2;/q;-1/p+1 |
| InChIKey | GFIFKHHJQPETMS-UHFFFAOYSA-O |
| XLogP | 5.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate?
The IUPAC name of hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate (CID 162307739) is hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate.
What is the SMILES notation for hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate?
The canonical SMILES for hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate is F[P-](F)(F)(F)(F)F.O=C(CN1C=CC=CC1)c1ccccc1.[H+].
What is the InChIKey of hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate?
The InChIKey is GFIFKHHJQPETMS-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H13NO.F6P/c15-13(12-7-3-1-4-8-12)11-14-9-5-2-6-10-14;1-7(2,3,4,5)6/h1-9H,10-11H2;/q;-1/p+1.
What are the key properties of hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate?
hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate has a molecular weight of 345.22 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;1-phenyl-2-(2H-pyridin-1-yl)ethanone;hexafluorophosphate is sourced from PubChem (CID 162307739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).