About 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride
5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride (PubChem CID 162308639) has the molecular formula C4H8ClN3O2
and a molecular weight of 165.58 g/mol. Its IUPAC name is 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride |
| PubChem CID | 162308639 |
| Molecular Formula | C4H8ClN3O2 |
| Molecular Weight | 165.58 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.NCC1NC(=O)NC1=O |
| InChI | InChI=1S/C4H7N3O2.ClH/c5-1-2-3(8)7-4(9)6-2;/h2H,1,5H2,(H2,6,7,8,9);1H |
| InChIKey | XNUWFXSMLYVGPB-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.58 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride?
The IUPAC name of 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride (CID 162308639) is 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride.
What is the SMILES notation for 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride?
The canonical SMILES for 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride is Cl.NCC1NC(=O)NC1=O.
What is the InChIKey of 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride?
The InChIKey is XNUWFXSMLYVGPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O2.ClH/c5-1-2-3(8)7-4(9)6-2;/h2H,1,5H2,(H2,6,7,8,9);1H.
What are the key properties of 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride?
5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride has a molecular weight of 165.58 g/mol, XLogP of -1.43, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)imidazolidine-2,4-dione;hydrochloride is sourced from PubChem (CID 162308639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).