About 2H-pyrrolo[3,2-b]pyridine;dihydrochloride
2H-pyrrolo[3,2-b]pyridine;dihydrochloride (PubChem CID 162311093) has the molecular formula C7H8Cl2N2
and a molecular weight of 191.06 g/mol. Its IUPAC name is 2H-pyrrolo[3,2-b]pyridine;dihydrochloride.
Molecular Properties
| Compound Name | 2H-pyrrolo[3,2-b]pyridine;dihydrochloride |
| PubChem CID | 162311093 |
| Molecular Formula | C7H8Cl2N2 |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 2H-pyrrolo[3,2-b]pyridine;dihydrochloride |
| SMILES | C1=c2ncccc2=NC1.Cl.Cl |
| InChI | InChI=1S/C7H6N2.2ClH/c1-2-6-7(8-4-1)3-5-9-6;;/h1-4H,5H2;2*1H |
| InChIKey | BOOOXVNWYQQYBG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-pyrrolo[3,2-b]pyridine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrrolo[3,2-b]pyridine;dihydrochloride?
The IUPAC name of 2H-pyrrolo[3,2-b]pyridine;dihydrochloride (CID 162311093) is 2H-pyrrolo[3,2-b]pyridine;dihydrochloride.
What is the SMILES notation for 2H-pyrrolo[3,2-b]pyridine;dihydrochloride?
The canonical SMILES for 2H-pyrrolo[3,2-b]pyridine;dihydrochloride is C1=c2ncccc2=NC1.Cl.Cl.
What is the InChIKey of 2H-pyrrolo[3,2-b]pyridine;dihydrochloride?
The InChIKey is BOOOXVNWYQQYBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.2ClH/c1-2-6-7(8-4-1)3-5-9-6;;/h1-4H,5H2;2*1H.
What are the key properties of 2H-pyrrolo[3,2-b]pyridine;dihydrochloride?
2H-pyrrolo[3,2-b]pyridine;dihydrochloride has a molecular weight of 191.06 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrrolo[3,2-b]pyridine;dihydrochloride is sourced from PubChem (CID 162311093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).