About 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride
1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride (PubChem CID 162311606) has the molecular formula C18H21ClFN3O2S
and a molecular weight of 397.90 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride |
| PubChem CID | 162311606 |
| Molecular Formula | C18H21ClFN3O2S |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride |
| SMILES | Cl.O=C(Nc1ncsc1-c1ccc(F)cc1)OCC12CCN(CC1)CC2 |
| InChI | InChI=1S/C18H20FN3O2S.ClH/c19-14-3-1-13(2-4-14)15-16(20-12-25-15)21-17(23)24-11-18-5-8-22(9-6-18)10-7-18;/h1-4,12H,5-11H2,(H,21,23);1H |
| InChIKey | ZGHNBGRZFRXWMV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride?
The IUPAC name of 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride (CID 162311606) is 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride.
What is the SMILES notation for 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride?
The canonical SMILES for 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride is Cl.O=C(Nc1ncsc1-c1ccc(F)cc1)OCC12CCN(CC1)CC2.
What is the InChIKey of 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride?
The InChIKey is ZGHNBGRZFRXWMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN3O2S.ClH/c19-14-3-1-13(2-4-14)15-16(20-12-25-15)21-17(23)24-11-18-5-8-22(9-6-18)10-7-18;/h1-4,12H,5-11H2,(H,21,23);1H.
What are the key properties of 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride?
1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride has a molecular weight of 397.90 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octan-4-ylmethyl N-[5-(4-fluorophenyl)-1,3-thiazol-4-yl]carbamate;hydrochloride is sourced from PubChem (CID 162311606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).