C26H32F4N4O6 — CID 162312034
1-[(2-fluoro-4-nitrophenyl)methyl]-1-(1-methylpiperidin-4-yl)-3-[(4-propan-2-yloxyphenyl)methyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 162312034) has the molecular formula C26H32F4N4O6 and a molecular weight of 572.56 g/mol. Its IUPAC name is 1-[(2-fluoro-4-nitrophenyl)methyl]-1-(1-methylpiperidin-4-yl)-3-[(4-propan-2-yloxyphenyl)methyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(2-fluoro-4-nitrophenyl)methyl]-1-(1-methylpiperidin-4-yl)-3-[(4-propan-2-yloxyphenyl)methyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162312034 |
| Molecular Formula | C26H32F4N4O6 |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 1-[(2-fluoro-4-nitrophenyl)methyl]-1-(1-methylpiperidin-4-yl)-3-[(4-propan-2-yloxyphenyl)methyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)Oc1ccc(CNC(=O)N(Cc2ccc([N+](=O)[O-])cc2F)C2CCN(C)CC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H31FN4O4.C2HF3O2/c1-17(2)33-22-8-4-18(5-9-22)15-26-24(30)28(20-10-12-27(3)13-11-20)16-19-6-7-21(29(31)32)14-23(19)25;3-2(4,5)1(6)7/h4-9,14,17,20H,10-13,15-16H2,1-3H3,(H,26,30);(H,6,7) |
| InChIKey | YMGPGPIJEGAJRR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|