About furan-3-carboxamide;2,2,2-trifluoroacetic acid
furan-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 162312485) has the molecular formula C7H6F3NO4
and a molecular weight of 225.12 g/mol. Its IUPAC name is furan-3-carboxamide;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | furan-3-carboxamide;2,2,2-trifluoroacetic acid |
| PubChem CID | 162312485 |
| Molecular Formula | C7H6F3NO4 |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | furan-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1ccoc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C5H5NO2.C2HF3O2/c6-5(7)4-1-2-8-3-4;3-2(4,5)1(6)7/h1-3H,(H2,6,7);(H,6,7) |
| InChIKey | AQODNVBMXWKERL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-3-carboxamide;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-carboxamide;2,2,2-trifluoroacetic acid?
The IUPAC name of furan-3-carboxamide;2,2,2-trifluoroacetic acid (CID 162312485) is furan-3-carboxamide;2,2,2-trifluoroacetic acid.
What is the SMILES notation for furan-3-carboxamide;2,2,2-trifluoroacetic acid?
The canonical SMILES for furan-3-carboxamide;2,2,2-trifluoroacetic acid is NC(=O)c1ccoc1.O=C(O)C(F)(F)F.
What is the InChIKey of furan-3-carboxamide;2,2,2-trifluoroacetic acid?
The InChIKey is AQODNVBMXWKERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO2.C2HF3O2/c6-5(7)4-1-2-8-3-4;3-2(4,5)1(6)7/h1-3H,(H2,6,7);(H,6,7).
What are the key properties of furan-3-carboxamide;2,2,2-trifluoroacetic acid?
furan-3-carboxamide;2,2,2-trifluoroacetic acid has a molecular weight of 225.12 g/mol, XLogP of 1.01, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-carboxamide;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 162312485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).