C9H12ClN3OS — CID 162313062
3-(2,5-dimethylfuran-3-yl)-4-methyl-1H-1,2,4-triazole-5-thione;hydrochloride (PubChem CID 162313062) has the molecular formula C9H12ClN3OS and a molecular weight of 245.73 g/mol. Its IUPAC name is 3-(2,5-dimethylfuran-3-yl)-4-methyl-1H-1,2,4-triazole-5-thione;hydrochloride.
| Compound Name | 3-(2,5-dimethylfuran-3-yl)-4-methyl-1H-1,2,4-triazole-5-thione;hydrochloride |
|---|---|
| PubChem CID | 162313062 |
| Molecular Formula | C9H12ClN3OS |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 3-(2,5-dimethylfuran-3-yl)-4-methyl-1H-1,2,4-triazole-5-thione;hydrochloride |
| SMILES | Cc1cc(-c2n[nH]c(=S)n2C)c(C)o1.Cl |
| InChI | InChI=1S/C9H11N3OS.ClH/c1-5-4-7(6(2)13-5)8-10-11-9(14)12(8)3;/h4H,1-3H3,(H,11,14);1H |
| InChIKey | VCCAAIGGIJXERI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|