About propan-2-ylcyclopropane;hydroiodide
propan-2-ylcyclopropane;hydroiodide (PubChem CID 162314014) has the molecular formula C6H13I
and a molecular weight of 212.07 g/mol. Its IUPAC name is propan-2-ylcyclopropane;hydroiodide.
Molecular Properties
| Compound Name | propan-2-ylcyclopropane;hydroiodide |
| PubChem CID | 162314014 |
| Molecular Formula | C6H13I |
| Molecular Weight | 212.07 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | propan-2-ylcyclopropane;hydroiodide |
| SMILES | CC(C)C1CC1.I |
| InChI | InChI=1S/C6H12.HI/c1-5(2)6-3-4-6;/h5-6H,3-4H2,1-2H3;1H |
| InChIKey | BKMAUHMXWWTSGE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.07 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ylcyclopropane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylcyclopropane;hydroiodide?
The IUPAC name of propan-2-ylcyclopropane;hydroiodide (CID 162314014) is propan-2-ylcyclopropane;hydroiodide.
What is the SMILES notation for propan-2-ylcyclopropane;hydroiodide?
The canonical SMILES for propan-2-ylcyclopropane;hydroiodide is CC(C)C1CC1.I.
What is the InChIKey of propan-2-ylcyclopropane;hydroiodide?
The InChIKey is BKMAUHMXWWTSGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.HI/c1-5(2)6-3-4-6;/h5-6H,3-4H2,1-2H3;1H.
What are the key properties of propan-2-ylcyclopropane;hydroiodide?
propan-2-ylcyclopropane;hydroiodide has a molecular weight of 212.07 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylcyclopropane;hydroiodide is sourced from PubChem (CID 162314014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).