About CID 162314144
CID 162314144 (PubChem CID 162314144) has the molecular formula C3H7N3NaO2
and a molecular weight of 140.10 g/mol.
Molecular Properties
| Compound Name | CID 162314144 |
| PubChem CID | 162314144 |
| Molecular Formula | C3H7N3NaO2 |
| Molecular Weight | 140.10 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | — |
| SMILES | CC(=O)ON=C(N)N.[Na] |
| InChI | InChI=1S/C3H7N3O2.Na/c1-2(7)8-6-3(4)5;/h1H3,(H4,4,5,6); |
| InChIKey | XALAGZIMTKJUAI-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.10 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 162314144 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162314144?
The IUPAC name of CID 162314144 (CID 162314144) is not available.
What is the SMILES notation for CID 162314144?
The canonical SMILES for CID 162314144 is CC(=O)ON=C(N)N.[Na].
What is the InChIKey of CID 162314144?
The InChIKey is XALAGZIMTKJUAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N3O2.Na/c1-2(7)8-6-3(4)5;/h1H3,(H4,4,5,6);.
What are the key properties of CID 162314144?
CID 162314144 has a molecular weight of 140.10 g/mol, XLogP of -1.64, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162314144 is sourced from PubChem (CID 162314144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).