About CID 162315217
CID 162315217 (PubChem CID 162315217) has the molecular formula C7HCl5NaO2
and a molecular weight of 317.34 g/mol.
Molecular Properties
| Compound Name | CID 162315217 |
| PubChem CID | 162315217 |
| Molecular Formula | C7HCl5NaO2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 314.83 |
| IUPAC Name | — |
| SMILES | O=C1C(Cl)=C(O)C2(Cl)C(Cl)=C(Cl)C12Cl.[Na] |
| InChI | InChI=1S/C7HCl5O2.Na/c8-1-4(13)6(11)2(9)3(10)7(6,12)5(1)14;/h13H; |
| InChIKey | UNZJMLIVPZDATI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze CID 162315217 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162315217?
The IUPAC name of CID 162315217 (CID 162315217) is not available.
What is the SMILES notation for CID 162315217?
The canonical SMILES for CID 162315217 is O=C1C(Cl)=C(O)C2(Cl)C(Cl)=C(Cl)C12Cl.[Na].
What is the InChIKey of CID 162315217?
The InChIKey is UNZJMLIVPZDATI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7HCl5O2.Na/c8-1-4(13)6(11)2(9)3(10)7(6,12)5(1)14;/h13H;.
What are the key properties of CID 162315217?
CID 162315217 has a molecular weight of 317.34 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162315217 is sourced from PubChem (CID 162315217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).