C17H26ClNO — CID 162315237
[4-(3-methylbutyl)phenyl]-piperidin-4-ylmethanone;hydrochloride (PubChem CID 162315237) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is [4-(3-methylbutyl)phenyl]-piperidin-4-ylmethanone;hydrochloride.
| Compound Name | [4-(3-methylbutyl)phenyl]-piperidin-4-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 162315237 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | [4-(3-methylbutyl)phenyl]-piperidin-4-ylmethanone;hydrochloride |
| SMILES | CC(C)CCc1ccc(C(=O)C2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C17H25NO.ClH/c1-13(2)3-4-14-5-7-15(8-6-14)17(19)16-9-11-18-12-10-16;/h5-8,13,16,18H,3-4,9-12H2,1-2H3;1H |
| InChIKey | ZQCWVZKLIOVAAE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |