C18H26Cl2F5N5O5S — CID 162315266
N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide;dihydrochloride (PubChem CID 162315266) has the molecular formula C18H26Cl2F5N5O5S and a molecular weight of 590.40 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide;dihydrochloride.
| Compound Name | N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162315266 |
| Molecular Formula | C18H26Cl2F5N5O5S |
| Molecular Weight | 590.40 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NO)C1(S(=O)(=O)N2CCN(c3cnc(CCC(F)(F)C(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C18H24F5N5O5S.2ClH/c19-17(20,18(21,22)23)2-1-13-11-25-14(12-24-13)27-5-7-28(8-6-27)34(31,32)16(15(29)26-30)3-9-33-10-4-16;;/h11-12,30H,1-10H2,(H,26,29);2*1H |
| InChIKey | RNJSUTPYZVEEGB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|