About 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride
5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride (PubChem CID 162315419) has the molecular formula C11H15Cl2N3O3
and a molecular weight of 308.17 g/mol. Its IUPAC name is 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride |
| PubChem CID | 162315419 |
| Molecular Formula | C11H15Cl2N3O3 |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride |
| SMILES | COc1cc2nc(N)ncc2c(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C11H13N3O3.2ClH/c1-15-8-4-7-6(5-13-11(12)14-7)9(16-2)10(8)17-3;;/h4-5H,1-3H3,(H2,12,13,14);2*1H |
| InChIKey | KWSNKBDCGYYEFV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride?
The IUPAC name of 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride (CID 162315419) is 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride.
What is the SMILES notation for 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride?
The canonical SMILES for 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride is COc1cc2nc(N)ncc2c(OC)c1OC.Cl.Cl.
What is the InChIKey of 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride?
The InChIKey is KWSNKBDCGYYEFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3.2ClH/c1-15-8-4-7-6(5-13-11(12)14-7)9(16-2)10(8)17-3;;/h4-5H,1-3H3,(H2,12,13,14);2*1H.
What are the key properties of 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride?
5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride has a molecular weight of 308.17 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7-trimethoxyquinazolin-2-amine;dihydrochloride is sourced from PubChem (CID 162315419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).