C20H31ClF3N11 — CID 162317426
(3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[2-[4-(trifluoromethyl)phenyl]hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride (PubChem CID 162317426) has the molecular formula C20H31ClF3N11 and a molecular weight of 517.99 g/mol. Its IUPAC name is (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[2-[4-(trifluoromethyl)phenyl]hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride.
| Compound Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[2-[4-(trifluoromethyl)phenyl]hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 162317426 |
| Molecular Formula | C20H31ClF3N11 |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (3R,5S)-1-[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[2-[4-(trifluoromethyl)phenyl]hydrazinyl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine;hydrochloride |
| SMILES | Cl.N[C@@H]1C[C@H](N)CN(c2nc(NNc3ccc(C(F)(F)F)cc3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C20H30F3N11.ClH/c21-20(22,23)11-1-3-16(4-2-11)31-32-17-28-18(33-7-12(24)5-13(25)8-33)30-19(29-17)34-9-14(26)6-15(27)10-34;/h1-4,12-15,31H,5-10,24-27H2,(H,28,29,30,32);1H/t12-,13+,14-,15+; |
| InChIKey | WTBRHNAMHHCXKP-KBAUWVDPSA-N |
| XLogP | 0.48 |
| TPSA | 173.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|