About silver;2-hydroxy-2-methylpropanoate;pyridine
silver;2-hydroxy-2-methylpropanoate;pyridine (PubChem CID 162318466) has the molecular formula C9H12AgNO3
and a molecular weight of 290.07 g/mol. Its IUPAC name is silver;2-hydroxy-2-methylpropanoate;pyridine.
Molecular Properties
| Compound Name | silver;2-hydroxy-2-methylpropanoate;pyridine |
| PubChem CID | 162318466 |
| Molecular Formula | C9H12AgNO3 |
| Molecular Weight | 290.07 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | silver;2-hydroxy-2-methylpropanoate;pyridine |
| SMILES | CC(C)(O)C(=O)[O-].[Ag+].c1ccncc1 |
| InChI | InChI=1S/C5H5N.C4H8O3.Ag/c1-2-4-6-5-3-1;1-4(2,7)3(5)6;/h1-5H;7H,1-2H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | RXMWLWLCYBSNET-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.07 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze silver;2-hydroxy-2-methylpropanoate;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;2-hydroxy-2-methylpropanoate;pyridine?
The IUPAC name of silver;2-hydroxy-2-methylpropanoate;pyridine (CID 162318466) is silver;2-hydroxy-2-methylpropanoate;pyridine.
What is the SMILES notation for silver;2-hydroxy-2-methylpropanoate;pyridine?
The canonical SMILES for silver;2-hydroxy-2-methylpropanoate;pyridine is CC(C)(O)C(=O)[O-].[Ag+].c1ccncc1.
What is the InChIKey of silver;2-hydroxy-2-methylpropanoate;pyridine?
The InChIKey is RXMWLWLCYBSNET-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5N.C4H8O3.Ag/c1-2-4-6-5-3-1;1-4(2,7)3(5)6;/h1-5H;7H,1-2H3,(H,5,6);/q;;+1/p-1.
What are the key properties of silver;2-hydroxy-2-methylpropanoate;pyridine?
silver;2-hydroxy-2-methylpropanoate;pyridine has a molecular weight of 290.07 g/mol, XLogP of -0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver;2-hydroxy-2-methylpropanoate;pyridine is sourced from PubChem (CID 162318466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).