About 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride
1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride (PubChem CID 162318741) has the molecular formula C18H24Cl3NO2
and a molecular weight of 392.75 g/mol. Its IUPAC name is 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride.
Molecular Properties
| Compound Name | 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride |
| PubChem CID | 162318741 |
| Molecular Formula | C18H24Cl3NO2 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride |
| SMILES | Cl.O=C1CCN(C2CCCC[C@@H]2OCCc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C18H23Cl2NO2.ClH/c19-15-4-3-5-16(20)14(15)9-11-23-18-7-2-1-6-17(18)21-10-8-13(22)12-21;/h3-5,17-18H,1-2,6-12H2;1H/t17?,18-;/m0./s1 |
| InChIKey | WWRXUXRQXKIOKJ-SZOUEMSFSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride?
The IUPAC name of 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride (CID 162318741) is 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride.
What is the SMILES notation for 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride?
The canonical SMILES for 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride is Cl.O=C1CCN(C2CCCC[C@@H]2OCCc2c(Cl)cccc2Cl)C1.
What is the InChIKey of 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride?
The InChIKey is WWRXUXRQXKIOKJ-SZOUEMSFSA-N. The full InChI is InChI=1S/C18H23Cl2NO2.ClH/c19-15-4-3-5-16(20)14(15)9-11-23-18-7-2-1-6-17(18)21-10-8-13(22)12-21;/h3-5,17-18H,1-2,6-12H2;1H/t17?,18-;/m0./s1.
What are the key properties of 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride?
1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride has a molecular weight of 392.75 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-2-[2-(2,6-dichlorophenyl)ethoxy]cyclohexyl]pyrrolidin-3-one;hydrochloride is sourced from PubChem (CID 162318741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).