C17H26Cl2F3N5O5S — CID 162318850
N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide;dihydrochloride (PubChem CID 162318850) has the molecular formula C17H26Cl2F3N5O5S and a molecular weight of 540.39 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide;dihydrochloride.
| Compound Name | N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162318850 |
| Molecular Formula | C17H26Cl2F3N5O5S |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | N-hydroxy-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]piperazin-1-yl]sulfonyloxane-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NO)C1(S(=O)(=O)N2CCN(c3cnc(CCC(F)(F)F)cn3)CC2)CCOCC1 |
| InChI | InChI=1S/C17H24F3N5O5S.2ClH/c18-17(19,20)2-1-13-11-22-14(12-21-13)24-5-7-25(8-6-24)31(28,29)16(15(26)23-27)3-9-30-10-4-16;;/h11-12,27H,1-10H2,(H,23,26);2*1H |
| InChIKey | XVKVLOUATCKBEM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|