C36H33F2N2NaO5S — CID 162319264
sodium 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[4-(2,4-difluorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate (PubChem CID 162319264) has the molecular formula C36H33F2N2NaO5S and a molecular weight of 666.72 g/mol. Its IUPAC name is sodium 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[4-(2,4-difluorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate.
| Compound Name | sodium 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[4-(2,4-difluorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 162319264 |
| Molecular Formula | C36H33F2N2NaO5S |
| Molecular Weight | 666.72 g/mol |
| Exact Mass | 666.20 |
| IUPAC Name | sodium 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[4-(2,4-difluorophenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)[O-])cc2)c2cc(-c3ccc(-c4ccc(F)cc4F)cc3)on2)cc1.[Na+] |
| InChI | InChI=1S/C36H34F2N2O5S.Na/c1-36(2,3)28-14-12-25(13-15-28)31(20-23-4-6-27(7-5-23)35(41)39-18-19-46(42,43)44)33-22-34(45-40-33)26-10-8-24(9-11-26)30-17-16-29(37)21-32(30)38;/h4-17,21-22,31H,18-20H2,1-3H3,(H,39,41)(H,42,43,44);/q;+1/p-1 |
| InChIKey | CWOMIAGSSKXKLL-UHFFFAOYSA-M |
| XLogP | 4.24 |
| TPSA | 112.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.72 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|