About bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide
bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide (PubChem CID 162319391) has the molecular formula C10H6F9N3O5
and a molecular weight of 419.16 g/mol. Its IUPAC name is bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide |
| PubChem CID | 162319391 |
| Molecular Formula | C10H6F9N3O5 |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(C(F)(F)F)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H4F3N3O.2C2HF3O2/c7-6(8,9)5-11-2-1-3(12-5)4(10)13;2*3-2(4,5)1(6)7/h1-2H,(H2,10,13);2*(H,6,7) |
| InChIKey | BWRWPRWNZZXBJO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 143.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide?
The IUPAC name of bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide (CID 162319391) is bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide.
What is the SMILES notation for bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide?
The canonical SMILES for bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide is NC(=O)c1ccnc(C(F)(F)F)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.
What is the InChIKey of bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide?
The InChIKey is BWRWPRWNZZXBJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3N3O.2C2HF3O2/c7-6(8,9)5-11-2-1-3(12-5)4(10)13;2*3-2(4,5)1(6)7/h1-2H,(H2,10,13);2*(H,6,7).
What are the key properties of bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide?
bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide has a molecular weight of 419.16 g/mol, XLogP of 1.86, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2,2-trifluoroacetic acid);2-(trifluoromethyl)pyrimidine-4-carboxamide is sourced from PubChem (CID 162319391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).