About 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride
4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride (PubChem CID 162320065) has the molecular formula C12H16ClFN2S
and a molecular weight of 274.79 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride |
| PubChem CID | 162320065 |
| Molecular Formula | C12H16ClFN2S |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride |
| SMILES | CC1(c2ccc(F)cc2)CCCSC(N)=N1.Cl |
| InChI | InChI=1S/C12H15FN2S.ClH/c1-12(7-2-8-16-11(14)15-12)9-3-5-10(13)6-4-9;/h3-6H,2,7-8H2,1H3,(H2,14,15);1H |
| InChIKey | VCYVZZPINRRARS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride?
The IUPAC name of 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride (CID 162320065) is 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride.
What is the SMILES notation for 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride?
The canonical SMILES for 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride is CC1(c2ccc(F)cc2)CCCSC(N)=N1.Cl.
What is the InChIKey of 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride?
The InChIKey is VCYVZZPINRRARS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FN2S.ClH/c1-12(7-2-8-16-11(14)15-12)9-3-5-10(13)6-4-9;/h3-6H,2,7-8H2,1H3,(H2,14,15);1H.
What are the key properties of 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride?
4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride has a molecular weight of 274.79 g/mol, XLogP of 3.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-4-methyl-6,7-dihydro-5H-1,3-thiazepin-2-amine;hydrochloride is sourced from PubChem (CID 162320065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).