About 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride
1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride (PubChem CID 162320660) has the molecular formula C9H17ClN2
and a molecular weight of 188.70 g/mol. Its IUPAC name is 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride |
| PubChem CID | 162320660 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride |
| SMILES | CCN1C=CC=C(N(C)C)C1.Cl |
| InChI | InChI=1S/C9H16N2.ClH/c1-4-11-7-5-6-9(8-11)10(2)3;/h5-7H,4,8H2,1-3H3;1H |
| InChIKey | GUZFHYUJBVGJTA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride?
The IUPAC name of 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride (CID 162320660) is 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride.
What is the SMILES notation for 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride?
The canonical SMILES for 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride is CCN1C=CC=C(N(C)C)C1.Cl.
What is the InChIKey of 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride?
The InChIKey is GUZFHYUJBVGJTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.ClH/c1-4-11-7-5-6-9(8-11)10(2)3;/h5-7H,4,8H2,1-3H3;1H.
What are the key properties of 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride?
1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride has a molecular weight of 188.70 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N,N-dimethyl-2H-pyridin-3-amine;hydrochloride is sourced from PubChem (CID 162320660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).