C26H28ClNa2O7P+2 — CID 162321149
disodium;[2-chloro-5-(3-phenoxyspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridec-2(7)-ene]-3-yl)phenyl] dihydrogen phosphate (PubChem CID 162321149) has the molecular formula C26H28ClNa2O7P+2 and a molecular weight of 564.91 g/mol. Its IUPAC name is disodium;[2-chloro-5-(3-phenoxyspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridec-2(7)-ene]-3-yl)phenyl] dihydrogen phosphate.
| Compound Name | disodium;[2-chloro-5-(3-phenoxyspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridec-2(7)-ene]-3-yl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 162321149 |
| Molecular Formula | C26H28ClNa2O7P+2 |
| Molecular Weight | 564.91 g/mol |
| Exact Mass | 564.10 |
| IUPAC Name | disodium;[2-chloro-5-(3-phenoxyspiro[dioxetane-4,13'-tricyclo[7.3.1.02,7]tridec-2(7)-ene]-3-yl)phenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cc(C2(Oc3ccccc3)OOC23C2CCCC3C3=C(CCCC3)C2)ccc1Cl.[Na+].[Na+] |
| InChI | InChI=1S/C26H28ClO7P.2Na/c27-23-14-13-19(16-24(23)32-35(28,29)30)26(31-20-9-2-1-3-10-20)25(33-34-26)18-8-6-12-22(25)21-11-5-4-7-17(21)15-18;;/h1-3,9-10,13-14,16,18,22H,4-8,11-12,15H2,(H2,28,29,30);;/q;2*+1 |
| InChIKey | JRJCIHNRIYESJA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.91 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|