C23H34Cl2F4N4O4S — CID 162321745
1-cyclopropyl-4-[4-[3-fluoro-4-(4,4,4-trifluorobutyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride (PubChem CID 162321745) has the molecular formula C23H34Cl2F4N4O4S and a molecular weight of 609.51 g/mol. Its IUPAC name is 1-cyclopropyl-4-[4-[3-fluoro-4-(4,4,4-trifluorobutyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride.
| Compound Name | 1-cyclopropyl-4-[4-[3-fluoro-4-(4,4,4-trifluorobutyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162321745 |
| Molecular Formula | C23H34Cl2F4N4O4S |
| Molecular Weight | 609.51 g/mol |
| Exact Mass | 608.16 |
| IUPAC Name | 1-cyclopropyl-4-[4-[3-fluoro-4-(4,4,4-trifluorobutyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxypiperidine-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(CCCC(F)(F)F)c(F)c3)CC2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C23H32F4N4O4S.2ClH/c24-20-16-19(4-3-17(20)2-1-7-23(25,26)27)30-12-14-31(15-13-30)36(34,35)22(21(32)28-33)8-10-29(11-9-22)18-5-6-18;;/h3-4,16,18,33H,1-2,5-15H2,(H,28,32);2*1H |
| InChIKey | FLOLMNZGFSRPQC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|