About 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide
5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide (PubChem CID 162321762) has the molecular formula C14H18BrCl2N3O2
and a molecular weight of 411.13 g/mol. Its IUPAC name is 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide.
Molecular Properties
| Compound Name | 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide |
| PubChem CID | 162321762 |
| Molecular Formula | C14H18BrCl2N3O2 |
| Molecular Weight | 411.13 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide |
| SMILES | Br.CCN(CC)CCn1cnc2c(O)c(Cl)cc(Cl)c2c1=O |
| InChI | InChI=1S/C14H17Cl2N3O2.BrH/c1-3-18(4-2)5-6-19-8-17-12-11(14(19)21)9(15)7-10(16)13(12)20;/h7-8,20H,3-6H2,1-2H3;1H |
| InChIKey | KBTAHAVVSUZDIM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.13 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide?
The IUPAC name of 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide (CID 162321762) is 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide.
What is the SMILES notation for 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide?
The canonical SMILES for 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide is Br.CCN(CC)CCn1cnc2c(O)c(Cl)cc(Cl)c2c1=O.
What is the InChIKey of 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide?
The InChIKey is KBTAHAVVSUZDIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2N3O2.BrH/c1-3-18(4-2)5-6-19-8-17-12-11(14(19)21)9(15)7-10(16)13(12)20;/h7-8,20H,3-6H2,1-2H3;1H.
What are the key properties of 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide?
5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide has a molecular weight of 411.13 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-[2-(diethylamino)ethyl]-8-hydroxyquinazolin-4-one;hydrobromide is sourced from PubChem (CID 162321762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).